C18H21N5O2 — CID 135412907
10-ethyl-8-methyl-2-piperidin-1-yl-3H-pyrimido[4,5-b][1,8]naphthyridine-4,5-dione (PubChem CID 135412907) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 10-ethyl-8-methyl-2-piperidin-1-yl-3H-pyrimido[4,5-b][1,8]naphthyridine-4,5-dione.
| Compound Name | 10-ethyl-8-methyl-2-piperidin-1-yl-3H-pyrimido[4,5-b][1,8]naphthyridine-4,5-dione |
|---|---|
| PubChem CID | 135412907 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 10-ethyl-8-methyl-2-piperidin-1-yl-3H-pyrimido[4,5-b][1,8]naphthyridine-4,5-dione |
| SMILES | CCn1c2nc(C)ccc2c(=O)c2c(=O)[nH]c(N3CCCCC3)nc21 |
| InChI | InChI=1S/C18H21N5O2/c1-3-23-15-12(8-7-11(2)19-15)14(24)13-16(23)20-18(21-17(13)25)22-9-5-4-6-10-22/h7-8H,3-6,9-10H2,1-2H3,(H,20,21,25) |
| InChIKey | ZJMZZTBDEHTTKP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|