C20H25N5O2 — CID 135720959
9-methyl-7-(3-phenylpropyl)-2-piperidin-1-yl-1H-purine-6,8-dione (PubChem CID 135720959) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 9-methyl-7-(3-phenylpropyl)-2-piperidin-1-yl-1H-purine-6,8-dione.
| Compound Name | 9-methyl-7-(3-phenylpropyl)-2-piperidin-1-yl-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 135720959 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 9-methyl-7-(3-phenylpropyl)-2-piperidin-1-yl-1H-purine-6,8-dione |
| SMILES | Cn1c(=O)n(CCCc2ccccc2)c2c(=O)[nH]c(N3CCCCC3)nc21 |
| InChI | InChI=1S/C20H25N5O2/c1-23-17-16(18(26)22-19(21-17)24-12-6-3-7-13-24)25(20(23)27)14-8-11-15-9-4-2-5-10-15/h2,4-5,9-10H,3,6-8,11-14H2,1H3,(H,21,22,26) |
| InChIKey | GBRQRIBRBJYSEZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |