C14H14N2O6S — CID 20562292
(1-benzyl-3-carbamoyl-2-hydroxy-6-oxo-4-pyridinyl)methanesulfonic acid (PubChem CID 20562292) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is (1-benzyl-3-carbamoyl-2-hydroxy-6-oxo-4-pyridinyl)methanesulfonic acid.
| Compound Name | (1-benzyl-3-carbamoyl-2-hydroxy-6-oxo-4-pyridinyl)methanesulfonic acid |
|---|---|
| PubChem CID | 20562292 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (1-benzyl-3-carbamoyl-2-hydroxy-6-oxo-4-pyridinyl)methanesulfonic acid |
| SMILES | NC(=O)c1c(CS(=O)(=O)O)cc(=O)n(Cc2ccccc2)c1O |
| InChI | InChI=1S/C14H14N2O6S/c15-13(18)12-10(8-23(20,21)22)6-11(17)16(14(12)19)7-9-4-2-1-3-5-9/h1-6,19H,7-8H2,(H2,15,18)(H,20,21,22) |
| InChIKey | WFRBDTBNSWSTJA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|