C11H15NO7S2 — CID 57086682
2-[benzoyl(2-sulfoethyl)amino]ethanesulfonic acid (PubChem CID 57086682) has the molecular formula C11H15NO7S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[benzoyl(2-sulfoethyl)amino]ethanesulfonic acid.
| Compound Name | 2-[benzoyl(2-sulfoethyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 57086682 |
| Molecular Formula | C11H15NO7S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-[benzoyl(2-sulfoethyl)amino]ethanesulfonic acid |
| SMILES | O=C(c1ccccc1)N(CCS(=O)(=O)O)CCS(=O)(=O)O |
| InChI | InChI=1S/C11H15NO7S2/c13-11(10-4-2-1-3-5-10)12(6-8-20(14,15)16)7-9-21(17,18)19/h1-5H,6-9H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | KQBZWFAKMKRQRP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|