C22H17N3O2 — CID 20565147
3-(2,3-diaminophenyl)-3-(1H-indol-2-yl)-2-benzofuran-1-one (PubChem CID 20565147) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-(2,3-diaminophenyl)-3-(1H-indol-2-yl)-2-benzofuran-1-one.
| Compound Name | 3-(2,3-diaminophenyl)-3-(1H-indol-2-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 20565147 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-(2,3-diaminophenyl)-3-(1H-indol-2-yl)-2-benzofuran-1-one |
| SMILES | Nc1cccc(C2(c3cc4ccccc4[nH]3)OC(=O)c3ccccc32)c1N |
| InChI | InChI=1S/C22H17N3O2/c23-17-10-5-9-16(20(17)24)22(15-8-3-2-7-14(15)21(26)27-22)19-12-13-6-1-4-11-18(13)25-19/h1-12,25H,23-24H2 |
| InChIKey | ZSILJWQSKXMFND-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|