About acetaldehyde;2-hex-1-en-3-yloxyethyl acetate
acetaldehyde;2-hex-1-en-3-yloxyethyl acetate (PubChem CID 20565579) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is acetaldehyde;2-hex-1-en-3-yloxyethyl acetate.
Molecular Properties
| Compound Name | acetaldehyde;2-hex-1-en-3-yloxyethyl acetate |
| PubChem CID | 20565579 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | acetaldehyde;2-hex-1-en-3-yloxyethyl acetate |
| SMILES | C=CC(CCC)OCCOC(C)=O.CC=O |
| InChI | InChI=1S/C10H18O3.C2H4O/c1-4-6-10(5-2)13-8-7-12-9(3)11;1-2-3/h5,10H,2,4,6-8H2,1,3H3;2H,1H3 |
| InChIKey | ZJAHZSOVXDQCJH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;2-hex-1-en-3-yloxyethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;2-hex-1-en-3-yloxyethyl acetate?
The IUPAC name of acetaldehyde;2-hex-1-en-3-yloxyethyl acetate (CID 20565579) is acetaldehyde;2-hex-1-en-3-yloxyethyl acetate.
What is the SMILES notation for acetaldehyde;2-hex-1-en-3-yloxyethyl acetate?
The canonical SMILES for acetaldehyde;2-hex-1-en-3-yloxyethyl acetate is C=CC(CCC)OCCOC(C)=O.CC=O.
What is the InChIKey of acetaldehyde;2-hex-1-en-3-yloxyethyl acetate?
The InChIKey is ZJAHZSOVXDQCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3.C2H4O/c1-4-6-10(5-2)13-8-7-12-9(3)11;1-2-3/h5,10H,2,4,6-8H2,1,3H3;2H,1H3.
What are the key properties of acetaldehyde;2-hex-1-en-3-yloxyethyl acetate?
acetaldehyde;2-hex-1-en-3-yloxyethyl acetate has a molecular weight of 230.30 g/mol, XLogP of 2.13, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;2-hex-1-en-3-yloxyethyl acetate is sourced from PubChem (CID 20565579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).