C12H11BrClN3O2 — CID 20565773
5-bromo-2-[3-(chloromethyl)-5-ethyl-1,2,4-triazol-4-yl]benzoic acid (PubChem CID 20565773) has the molecular formula C12H11BrClN3O2 and a molecular weight of 344.60 g/mol. Its IUPAC name is 5-bromo-2-[3-(chloromethyl)-5-ethyl-1,2,4-triazol-4-yl]benzoic acid.
| Compound Name | 5-bromo-2-[3-(chloromethyl)-5-ethyl-1,2,4-triazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 20565773 |
| Molecular Formula | C12H11BrClN3O2 |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 5-bromo-2-[3-(chloromethyl)-5-ethyl-1,2,4-triazol-4-yl]benzoic acid |
| SMILES | CCc1nnc(CCl)n1-c1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C12H11BrClN3O2/c1-2-10-15-16-11(6-14)17(10)9-4-3-7(13)5-8(9)12(18)19/h3-5H,2,6H2,1H3,(H,18,19) |
| InChIKey | OGNSYCUEODVGOT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|