C22H25ClO4 — CID 20566900
2-[2-(5-chloro-2-hydroxybenzoyl)phenyl]-7-methyloctanoic acid (PubChem CID 20566900) has the molecular formula C22H25ClO4 and a molecular weight of 388.89 g/mol. Its IUPAC name is 2-[2-(5-chloro-2-hydroxybenzoyl)phenyl]-7-methyloctanoic acid.
| Compound Name | 2-[2-(5-chloro-2-hydroxybenzoyl)phenyl]-7-methyloctanoic acid |
|---|---|
| PubChem CID | 20566900 |
| Molecular Formula | C22H25ClO4 |
| Molecular Weight | 388.89 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[2-(5-chloro-2-hydroxybenzoyl)phenyl]-7-methyloctanoic acid |
| SMILES | CC(C)CCCCC(C(=O)O)c1ccccc1C(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C22H25ClO4/c1-14(2)7-3-4-10-18(22(26)27)16-8-5-6-9-17(16)21(25)19-13-15(23)11-12-20(19)24/h5-6,8-9,11-14,18,24H,3-4,7,10H2,1-2H3,(H,26,27) |
| InChIKey | SAAHRWHSRQZRJB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.89 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|