C15H24O2 — CID 20569399
2-but-3-enyl-2-(3,3-dimethylcyclohexen-1-yl)-1,3-dioxolane (PubChem CID 20569399) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-but-3-enyl-2-(3,3-dimethylcyclohexen-1-yl)-1,3-dioxolane.
| Compound Name | 2-but-3-enyl-2-(3,3-dimethylcyclohexen-1-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 20569399 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-but-3-enyl-2-(3,3-dimethylcyclohexen-1-yl)-1,3-dioxolane |
| SMILES | C=CCCC1(C2=CC(C)(C)CCC2)OCCO1 |
| InChI | InChI=1S/C15H24O2/c1-4-5-9-15(16-10-11-17-15)13-7-6-8-14(2,3)12-13/h4,12H,1,5-11H2,2-3H3 |
| InChIKey | JSZDNBGDMCDATC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|