C13H10O3S — CID 20570530
7-hydroxy-4-thiophen-2-yl-3,4-dihydrochromen-2-one (PubChem CID 20570530) has the molecular formula C13H10O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 7-hydroxy-4-thiophen-2-yl-3,4-dihydrochromen-2-one.
| Compound Name | 7-hydroxy-4-thiophen-2-yl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 20570530 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 7-hydroxy-4-thiophen-2-yl-3,4-dihydrochromen-2-one |
| SMILES | O=C1CC(c2cccs2)c2ccc(O)cc2O1 |
| InChI | InChI=1S/C13H10O3S/c14-8-3-4-9-10(12-2-1-5-17-12)7-13(15)16-11(9)6-8/h1-6,10,14H,7H2 |
| InChIKey | YNSRNHXETUQRND-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|