C8H15F3N2O2S — CID 20571268
1,1,1-trifluoro-N-(1-piperidin-2-ylethyl)methanesulfonamide (PubChem CID 20571268) has the molecular formula C8H15F3N2O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(1-piperidin-2-ylethyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(1-piperidin-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 20571268 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1,1,1-trifluoro-N-(1-piperidin-2-ylethyl)methanesulfonamide |
| SMILES | CC(C1CCCCN1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2S/c1-6(7-4-2-3-5-12-7)13-16(14,15)8(9,10)11/h6-7,12-13H,2-5H2,1H3 |
| InChIKey | VHCCUDHRWZMBPN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 323 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |