C6H11F3N2O2S — CID 11117910
1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide (PubChem CID 11117910) has the molecular formula C6H11F3N2O2S and a molecular weight of 232.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide |
|---|---|
| PubChem CID | 11117910 |
| Molecular Formula | C6H11F3N2O2S |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide |
| SMILES | O=S(=O)(NC1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O2S/c7-6(8,9)14(12,13)11-5-1-3-10-4-2-5/h5,10-11H,1-4H2 |
| InChIKey | DCHMQOZPVFTNEM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |