About N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride
N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride (PubChem CID 75481816) has the molecular formula C7H15ClF3N3O2S
and a molecular weight of 297.73 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride |
| PubChem CID | 75481816 |
| Molecular Formula | C7H15ClF3N3O2S |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride |
| SMILES | Cl.O=S(=O)(NCC(F)(F)F)NC1CCNCC1 |
| InChI | InChI=1S/C7H14F3N3O2S.ClH/c8-7(9,10)5-12-16(14,15)13-6-1-3-11-4-2-6;/h6,11-13H,1-5H2;1H |
| InChIKey | QYJAIHXWDGGBLF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride?
The IUPAC name of N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride (CID 75481816) is N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride.
What is the SMILES notation for N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride?
The canonical SMILES for N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride is Cl.O=S(=O)(NCC(F)(F)F)NC1CCNCC1.
What is the InChIKey of N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride?
The InChIKey is QYJAIHXWDGGBLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3N3O2S.ClH/c8-7(9,10)5-12-16(14,15)13-6-1-3-11-4-2-6;/h6,11-13H,1-5H2;1H.
What are the key properties of N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride?
N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride has a molecular weight of 297.73 g/mol, XLogP of 0.15, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2,2-trifluoroethylsulfamoyl)piperidin-4-amine;hydrochloride is sourced from PubChem (CID 75481816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).