About 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one
2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one (PubChem CID 20571469) has the molecular formula C21H44O4Si3
and a molecular weight of 444.84 g/mol. Its IUPAC name is 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one |
| PubChem CID | 20571469 |
| Molecular Formula | C21H44O4Si3 |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one |
| SMILES | C[Si](C)(C)OCC(CCCCCC1=CC(O[Si](C)(C)C)CC1=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H44O4Si3/c1-26(2,3)23-17-19(24-27(4,5)6)14-12-10-11-13-18-15-20(16-21(18)22)25-28(7,8)9/h15,19-20H,10-14,16-17H2,1-9H3 |
| InChIKey | BMTOAKAZSNPUGO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one?
The IUPAC name of 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one (CID 20571469) is 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one.
What is the SMILES notation for 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one?
The canonical SMILES for 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one is C[Si](C)(C)OCC(CCCCCC1=CC(O[Si](C)(C)C)CC1=O)O[Si](C)(C)C.
What is the InChIKey of 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one?
The InChIKey is BMTOAKAZSNPUGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O4Si3/c1-26(2,3)23-17-19(24-27(4,5)6)14-12-10-11-13-18-15-20(16-21(18)22)25-28(7,8)9/h15,19-20H,10-14,16-17H2,1-9H3.
What are the key properties of 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one?
2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one has a molecular weight of 444.84 g/mol, XLogP of 6.13, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,7-bis(trimethylsilyloxy)heptyl]-4-trimethylsilyloxycyclopent-2-en-1-one is sourced from PubChem (CID 20571469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).