C7H3N7O2 — CID 20574098
9-nitrotetrazolo[1,5-c][1,2,3]benzotriazine (PubChem CID 20574098) has the molecular formula C7H3N7O2 and a molecular weight of 217.15 g/mol. Its IUPAC name is 9-nitrotetrazolo[1,5-c][1,2,3]benzotriazine.
| Compound Name | 9-nitrotetrazolo[1,5-c][1,2,3]benzotriazine |
|---|---|
| PubChem CID | 20574098 |
| Molecular Formula | C7H3N7O2 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 9-nitrotetrazolo[1,5-c][1,2,3]benzotriazine |
| SMILES | O=[N+]([O-])c1ccc2nnn3nnnc3c2c1 |
| InChI | InChI=1S/C7H3N7O2/c15-14(16)4-1-2-6-5(3-4)7-9-10-12-13(7)11-8-6/h1-3H |
| InChIKey | KNSKQLMIBSBMRI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 112.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|