C14H8BrCl3O2 — CID 20574469
2-bromo-2-(3-chlorophenoxy)-1-(2,4-dichlorophenyl)ethanone (PubChem CID 20574469) has the molecular formula C14H8BrCl3O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-bromo-2-(3-chlorophenoxy)-1-(2,4-dichlorophenyl)ethanone.
| Compound Name | 2-bromo-2-(3-chlorophenoxy)-1-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 20574469 |
| Molecular Formula | C14H8BrCl3O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 391.88 |
| IUPAC Name | 2-bromo-2-(3-chlorophenoxy)-1-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)C(Br)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H8BrCl3O2/c15-14(20-10-3-1-2-8(16)6-10)13(19)11-5-4-9(17)7-12(11)18/h1-7,14H |
| InChIKey | KIHIGTOHIPSWID-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|