C17H35O4Zr+ — CID 20576045
[(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;2-methylpentane-2,4-diol;zirconium (PubChem CID 20576045) has the molecular formula C17H35O4Zr+ and a molecular weight of 394.69 g/mol. Its IUPAC name is [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;2-methylpentane-2,4-diol;zirconium.
| Compound Name | [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;2-methylpentane-2,4-diol;zirconium |
|---|---|
| PubChem CID | 20576045 |
| Molecular Formula | C17H35O4Zr+ |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;2-methylpentane-2,4-diol;zirconium |
| SMILES | CC(O)CC(C)(C)O.[H]/[O+]=C(/C=C(\O)C(C)(C)C)C(C)(C)C.[Zr] |
| InChI | InChI=1S/C11H20O2.C6H14O2.Zr/c1-10(2,3)8(12)7-9(13)11(4,5)6;1-5(7)4-6(2,3)8;/h7,12H,1-6H3;5,7-8H,4H2,1-3H3;/p+1/b8-7-;; |
| InChIKey | JABORBCQMDGJNP-OTMFCZTRSA-O |
| XLogP | 3.59 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|