C15H31O3Ta+ — CID 58943021
[(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;2-methylpropan-2-ol;tantalum (PubChem CID 58943021) has the molecular formula C15H31O3Ta+ and a molecular weight of 440.36 g/mol. Its IUPAC name is [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;2-methylpropan-2-ol;tantalum.
| Compound Name | [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;2-methylpropan-2-ol;tantalum |
|---|---|
| PubChem CID | 58943021 |
| Molecular Formula | C15H31O3Ta+ |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-ylidene]oxidanium;2-methylpropan-2-ol;tantalum |
| SMILES | CC(C)(C)O.[H]/[O+]=C(/C=C(\O)C(C)(C)C)C(C)(C)C.[Ta] |
| InChI | InChI=1S/C11H20O2.C4H10O.Ta/c1-10(2,3)8(12)7-9(13)11(4,5)6;1-4(2,3)5;/h7,12H,1-6H3;5H,1-3H3;/p+1/b8-7-;; |
| InChIKey | QLPFCFDVCNTRPQ-OTMFCZTRSA-O |
| XLogP | 3.84 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|