C11H21O2Pb+ — CID 159294845
(2,2,6,6-tetramethyl-5-oxoniumylidenehept-3-en-3-yl)oxy-λ2-plumbane (PubChem CID 159294845) has the molecular formula C11H21O2Pb+ and a molecular weight of 392.49 g/mol. Its IUPAC name is (2,2,6,6-tetramethyl-5-oxoniumylidenehept-3-en-3-yl)oxy-λ2-plumbane.
| Compound Name | (2,2,6,6-tetramethyl-5-oxoniumylidenehept-3-en-3-yl)oxy-λ2-plumbane |
|---|---|
| PubChem CID | 159294845 |
| Molecular Formula | C11H21O2Pb+ |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (2,2,6,6-tetramethyl-5-oxoniumylidenehept-3-en-3-yl)oxy-λ2-plumbane |
| SMILES | [H]/[O+]=C(/C=C(O[PbH])C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H20O2.Pb.H/c1-10(2,3)8(12)7-9(13)11(4,5)6;;/h7,12H,1-6H3;;/q;+1; |
| InChIKey | UDRDBWLRVNAUFM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|