C22H44CuO4+4 — CID 5033021
copper;bis((2,2,6,6-tetramethyl-5-oxoniumylideneheptan-3-ylidene)oxidanium) (PubChem CID 5033021) has the molecular formula C22H44CuO4+4 and a molecular weight of 436.14 g/mol. Its IUPAC name is copper;bis((2,2,6,6-tetramethyl-5-oxoniumylideneheptan-3-ylidene)oxidanium).
| Compound Name | copper;bis((2,2,6,6-tetramethyl-5-oxoniumylideneheptan-3-ylidene)oxidanium) |
|---|---|
| PubChem CID | 5033021 |
| Molecular Formula | C22H44CuO4+4 |
| Molecular Weight | 436.14 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | copper;bis((2,2,6,6-tetramethyl-5-oxoniumylideneheptan-3-ylidene)oxidanium) |
| SMILES | [Cu].[H]/[O+]=C(/C/C(=[O+]/[H])C(C)(C)C)C(C)(C)C.[H]/[O+]=C(/C/C(=[O+]/[H])C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/2C11H20O2.Cu/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7H2,1-6H3;/p+4 |
| InChIKey | LJNKLCWPWAPYME-UHFFFAOYSA-R |
| XLogP | 5.11 |
| TPSA | 85.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.14 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|