About λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium
λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium (PubChem CID 50909714) has the molecular formula C5H10O2Tl+2
and a molecular weight of 306.52 g/mol. Its IUPAC name is λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium.
Molecular Properties
| Compound Name | λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium |
| PubChem CID | 50909714 |
| Molecular Formula | C5H10O2Tl+2 |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium |
| SMILES | [H]/[O+]=C(\C)C/C(C)=[O+]/[H].[Tl] |
| InChI | InChI=1S/C5H8O2.Tl/c1-4(6)3-5(2)7;/h3H2,1-2H3;/p+2 |
| InChIKey | YVOJIIUXXCKQRJ-UHFFFAOYSA-P |
| XLogP | 0.13 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium?
The IUPAC name of λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium (CID 50909714) is λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium.
What is the SMILES notation for λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium?
The canonical SMILES for λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium is [H]/[O+]=C(\C)C/C(C)=[O+]/[H].[Tl].
What is the InChIKey of λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium?
The InChIKey is YVOJIIUXXCKQRJ-UHFFFAOYSA-P. The full InChI is InChI=1S/C5H8O2.Tl/c1-4(6)3-5(2)7;/h3H2,1-2H3;/p+2.
What are the key properties of λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium?
λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium has a molecular weight of 306.52 g/mol, XLogP of 0.13, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for λ1-thallane;4-oxoniumylidenepentan-2-ylideneoxidanium is sourced from PubChem (CID 50909714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).