About bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium
bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium (PubChem CID 5165107) has the molecular formula C20H24O5V+4
and a molecular weight of 395.35 g/mol. Its IUPAC name is bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium.
Molecular Properties
| Compound Name | bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium |
| PubChem CID | 5165107 |
| Molecular Formula | C20H24O5V+4 |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium |
| SMILES | O=[V].[H]/[O+]=C(/C/C(C)=[O+]/[H])c1ccccc1.[H]/[O+]=C(/C/C(C)=[O+]/[H])c1ccccc1 |
| InChI | InChI=1S/2C10H10O2.O.V/c2*1-8(11)7-10(12)9-5-3-2-4-6-9;;/h2*2-6H,7H2,1H3;;/p+4 |
| InChIKey | VFGVRHLQEOCHGF-UHFFFAOYSA-R |
| XLogP | 2.95 |
| TPSA | 102.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium?
The IUPAC name of bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium (CID 5165107) is bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium.
What is the SMILES notation for bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium?
The canonical SMILES for bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium is O=[V].[H]/[O+]=C(/C/C(C)=[O+]/[H])c1ccccc1.[H]/[O+]=C(/C/C(C)=[O+]/[H])c1ccccc1.
What is the InChIKey of bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium?
The InChIKey is VFGVRHLQEOCHGF-UHFFFAOYSA-R. The full InChI is InChI=1S/2C10H10O2.O.V/c2*1-8(11)7-10(12)9-5-3-2-4-6-9;;/h2*2-6H,7H2,1H3;;/p+4.
What are the key properties of bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium?
bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium has a molecular weight of 395.35 g/mol, XLogP of 2.95, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis((4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium);oxovanadium is sourced from PubChem (CID 5165107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).