C26H38N2O6Pb+4 — CID 50934134
CID 50934134 (PubChem CID 50934134) has the molecular formula C26H38N2O6Pb+4 and a molecular weight of 681.80 g/mol.
| Compound Name | CID 50934134 |
|---|---|
| PubChem CID | 50934134 |
| Molecular Formula | C26H38N2O6Pb+4 |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | — |
| SMILES | [H]/[O+]=C(\[OH2+])C(CC(C)C)NC(=O)c1ccccc1.[H]/[O+]=C(\[OH2+])C(CC(C)C)NC(=O)c1ccccc1.[Pb] |
| InChI | InChI=1S/2C13H17NO3.Pb/c2*1-9(2)8-11(13(16)17)14-12(15)10-6-4-3-5-7-10;/h2*3-7,9,11H,8H2,1-2H3,(H,14,15)(H,16,17);/p+4 |
| InChIKey | PIORJQJYAMEKLX-UHFFFAOYSA-R |
| XLogP | 1.74 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|