C13H20NO3Pb+2 — CID 6386559
CID 6386559 (PubChem CID 6386559) has the molecular formula C13H20NO3Pb+2 and a molecular weight of 445.51 g/mol.
| Compound Name | CID 6386559 |
|---|---|
| PubChem CID | 6386559 |
| Molecular Formula | C13H20NO3Pb+2 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | — |
| SMILES | [H]/[O+]=C(/[OH2+])C(CC(C)C)NC(=O)c1ccccc1.[PbH] |
| InChI | InChI=1S/C13H17NO3.Pb.H/c1-9(2)8-11(13(16)17)14-12(15)10-6-4-3-5-7-10;;/h3-7,9,11H,8H2,1-2H3,(H,14,15)(H,16,17);;/p+2 |
| InChIKey | CUCXGJKAHFSGKN-UHFFFAOYSA-P |
| XLogP | 0.41 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|