C20H18CuF6O4+4 — CID 50912491
copper;bis((1,1,1-trifluoro-4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium) (PubChem CID 50912491) has the molecular formula C20H18CuF6O4+4 and a molecular weight of 499.89 g/mol. Its IUPAC name is copper;bis((1,1,1-trifluoro-4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium).
| Compound Name | copper;bis((1,1,1-trifluoro-4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium) |
|---|---|
| PubChem CID | 50912491 |
| Molecular Formula | C20H18CuF6O4+4 |
| Molecular Weight | 499.89 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | copper;bis((1,1,1-trifluoro-4-oxoniumylidene-4-phenylbutan-2-ylidene)oxidanium) |
| SMILES | [Cu].[H]/[O+]=C(/C/C(=[O+]/[H])C(F)(F)F)c1ccccc1.[H]/[O+]=C(/C/C(=[O+]/[H])C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/2C10H7F3O2.Cu/c2*11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7;/h2*1-5H,6H2;/p+4 |
| InChIKey | BDVVFUBNOKCILQ-UHFFFAOYSA-R |
| XLogP | 4.15 |
| TPSA | 85.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|