C22H18F6N2O2 — CID 123893642
1,1,1-trifluoro-4-phenyl-4-[2-[(4,4,4-trifluoro-3-oxo-1-phenylbutylidene)amino]ethylimino]butan-2-one (PubChem CID 123893642) has the molecular formula C22H18F6N2O2 and a molecular weight of 456.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-phenyl-4-[2-[(4,4,4-trifluoro-3-oxo-1-phenylbutylidene)amino]ethylimino]butan-2-one.
| Compound Name | 1,1,1-trifluoro-4-phenyl-4-[2-[(4,4,4-trifluoro-3-oxo-1-phenylbutylidene)amino]ethylimino]butan-2-one |
|---|---|
| PubChem CID | 123893642 |
| Molecular Formula | C22H18F6N2O2 |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1,1,1-trifluoro-4-phenyl-4-[2-[(4,4,4-trifluoro-3-oxo-1-phenylbutylidene)amino]ethylimino]butan-2-one |
| SMILES | O=C(C/C(=N\CC/N=C(\CC(=O)C(F)(F)F)c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H18F6N2O2/c23-21(24,25)19(31)13-17(15-7-3-1-4-8-15)29-11-12-30-18(14-20(32)22(26,27)28)16-9-5-2-6-10-16/h1-10H,11-14H2/b29-17+,30-18+ |
| InChIKey | YHKJQYSFNPLYCA-YAGSLNJISA-N |
| XLogP | 5.01 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|