C11H11F3N2O2 — CID 171757992
N'-(4,4,4-trifluorobutanoyl)benzohydrazide (PubChem CID 171757992) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is N'-(4,4,4-trifluorobutanoyl)benzohydrazide.
| Compound Name | N'-(4,4,4-trifluorobutanoyl)benzohydrazide |
|---|---|
| PubChem CID | 171757992 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N'-(4,4,4-trifluorobutanoyl)benzohydrazide |
| SMILES | O=C(CCC(F)(F)F)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-11(13,14)7-6-9(17)15-16-10(18)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,15,17)(H,16,18) |
| InChIKey | RJBYNRQGFKDDIA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|