About nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium)
nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium) (PubChem CID 5181668) has the molecular formula C32H32N2NiO2+2
and a molecular weight of 535.31 g/mol. Its IUPAC name is nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium).
Molecular Properties
| Compound Name | nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium) |
| PubChem CID | 5181668 |
| Molecular Formula | C32H32N2NiO2+2 |
| Molecular Weight | 535.31 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium) |
| SMILES | [H]/[O+]=C(/C/C(C)=N/c1ccccc1)c1ccccc1.[H]/[O+]=C(/C/C(C)=N/c1ccccc1)c1ccccc1.[Ni] |
| InChI | InChI=1S/2C16H15NO.Ni/c2*1-13(17-15-10-6-3-7-11-15)12-16(18)14-8-4-2-5-9-14;/h2*2-11H,12H2,1H3;/p+2/b2*17-13+; |
| InChIKey | JRENNGQKBXKUJW-QBLAQRQGSA-P |
| XLogP | 7.52 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.31 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium)?
The IUPAC name of nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium) (CID 5181668) is nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium).
What is the SMILES notation for nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium)?
The canonical SMILES for nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium) is [H]/[O+]=C(/C/C(C)=N/c1ccccc1)c1ccccc1.[H]/[O+]=C(/C/C(C)=N/c1ccccc1)c1ccccc1.[Ni].
What is the InChIKey of nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium)?
The InChIKey is JRENNGQKBXKUJW-QBLAQRQGSA-P. The full InChI is InChI=1S/2C16H15NO.Ni/c2*1-13(17-15-10-6-3-7-11-15)12-16(18)14-8-4-2-5-9-14;/h2*2-11H,12H2,1H3;/p+2/b2*17-13+;.
What are the key properties of nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium)?
nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium) has a molecular weight of 535.31 g/mol, XLogP of 7.52, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;bis((1-phenyl-3-phenyliminobutylidene)oxidanium) is sourced from PubChem (CID 5181668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).