About dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium)
dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium) (PubChem CID 50911194) has the molecular formula C10H20MoO6+4
and a molecular weight of 332.20 g/mol. Its IUPAC name is dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium).
Molecular Properties
| Compound Name | dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium) |
| PubChem CID | 50911194 |
| Molecular Formula | C10H20MoO6+4 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium) |
| SMILES | O=[Mo]=O.[H]/[O+]=C(\C)C/C(C)=[O+]/[H].[H]/[O+]=C(\C)C/C(C)=[O+]/[H] |
| InChI | InChI=1S/2C5H8O2.Mo.2O/c2*1-4(6)3-5(2)7;;;/h2*3H2,1-2H3;;;/p+4 |
| InChIKey | YVUTVJXMUXHZGH-UHFFFAOYSA-R |
| XLogP | 0.77 |
| TPSA | 119.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium)?
The IUPAC name of dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium) (CID 50911194) is dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium).
What is the SMILES notation for dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium)?
The canonical SMILES for dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium) is O=[Mo]=O.[H]/[O+]=C(\C)C/C(C)=[O+]/[H].[H]/[O+]=C(\C)C/C(C)=[O+]/[H].
What is the InChIKey of dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium)?
The InChIKey is YVUTVJXMUXHZGH-UHFFFAOYSA-R. The full InChI is InChI=1S/2C5H8O2.Mo.2O/c2*1-4(6)3-5(2)7;;;/h2*3H2,1-2H3;;;/p+4.
What are the key properties of dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium)?
dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium) has a molecular weight of 332.20 g/mol, XLogP of 0.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dioxomolybdenum;bis(4-oxoniumylidenepentan-2-ylideneoxidanium) is sourced from PubChem (CID 50911194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).