About dioxomolybdenum;pentane-2,4-dione
dioxomolybdenum;pentane-2,4-dione (PubChem CID 160782783) has the molecular formula C5H8MoO4
and a molecular weight of 228.05 g/mol. Its IUPAC name is dioxomolybdenum;pentane-2,4-dione.
Molecular Properties
| Compound Name | dioxomolybdenum;pentane-2,4-dione |
| PubChem CID | 160782783 |
| Molecular Formula | C5H8MoO4 |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | dioxomolybdenum;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.O=[Mo]=O |
| InChI | InChI=1S/C5H8O2.Mo.2O/c1-4(6)3-5(2)7;;;/h3H2,1-2H3;;; |
| InChIKey | SAUKGPBXGNAYSA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dioxomolybdenum;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxomolybdenum;pentane-2,4-dione?
The IUPAC name of dioxomolybdenum;pentane-2,4-dione (CID 160782783) is dioxomolybdenum;pentane-2,4-dione.
What is the SMILES notation for dioxomolybdenum;pentane-2,4-dione?
The canonical SMILES for dioxomolybdenum;pentane-2,4-dione is CC(=O)CC(C)=O.O=[Mo]=O.
What is the InChIKey of dioxomolybdenum;pentane-2,4-dione?
The InChIKey is SAUKGPBXGNAYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.Mo.2O/c1-4(6)3-5(2)7;;;/h3H2,1-2H3;;;.
What are the key properties of dioxomolybdenum;pentane-2,4-dione?
dioxomolybdenum;pentane-2,4-dione has a molecular weight of 228.05 g/mol, XLogP of 0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxomolybdenum;pentane-2,4-dione is sourced from PubChem (CID 160782783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).