About bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper
bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper (PubChem CID 5030631) has the molecular formula C22H44CuO4+4
and a molecular weight of 436.14 g/mol. Its IUPAC name is bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper.
Molecular Properties
| Compound Name | bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper |
| PubChem CID | 5030631 |
| Molecular Formula | C22H44CuO4+4 |
| Molecular Weight | 436.14 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper |
| SMILES | [Cu].[H]/[O+]=C(/C/C(CC(C)C)=[O+]/[H])C(C)(C)C.[H]/[O+]=C(/C/C(CC(C)C)=[O+]/[H])C(C)(C)C |
| InChI | InChI=1S/2C11H20O2.Cu/c2*1-8(2)6-9(12)7-10(13)11(3,4)5;/h2*8H,6-7H2,1-5H3;/p+4 |
| InChIKey | PXQXIHKSHOPRQF-UHFFFAOYSA-R |
| XLogP | 5.11 |
| TPSA | 85.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.14 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper?
The IUPAC name of bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper (CID 5030631) is bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper.
What is the SMILES notation for bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper?
The canonical SMILES for bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper is [Cu].[H]/[O+]=C(/C/C(CC(C)C)=[O+]/[H])C(C)(C)C.[H]/[O+]=C(/C/C(CC(C)C)=[O+]/[H])C(C)(C)C.
What is the InChIKey of bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper?
The InChIKey is PXQXIHKSHOPRQF-UHFFFAOYSA-R. The full InChI is InChI=1S/2C11H20O2.Cu/c2*1-8(2)6-9(12)7-10(13)11(3,4)5;/h2*8H,6-7H2,1-5H3;/p+4.
What are the key properties of bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper?
bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper has a molecular weight of 436.14 g/mol, XLogP of 5.11, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis((1-tert-butyl-5-methyl-3-oxoniumylidenehexylidene)oxidanium);copper is sourced from PubChem (CID 5030631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).