About 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one
2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 20576379) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
Analyze 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The IUPAC name of 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (CID 20576379) is 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
What is the SMILES notation for 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The canonical SMILES for 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one is CC12CC3C(=O)OC(C3C1)C2O.
What is the InChIKey of 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
The InChIKey is LFYQLXRFVHZTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-9-2-4-5(3-9)8(11)12-6(4)7(9)10/h4-7,10H,2-3H2,1H3.
What are the key properties of 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one?
2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one has a molecular weight of 168.19 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one is sourced from PubChem (CID 20576379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).