C21H20FN4O+ — CID 20577040
2-[4-(2,5-dihydro-1H-pyrrol-1-ium-1-ylmethyl)phenyl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 20577040) has the molecular formula C21H20FN4O+ and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[4-(2,5-dihydro-1H-pyrrol-1-ium-1-ylmethyl)phenyl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[4-(2,5-dihydro-1H-pyrrol-1-ium-1-ylmethyl)phenyl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 20577040 |
| Molecular Formula | C21H20FN4O+ |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[4-(2,5-dihydro-1H-pyrrol-1-ium-1-ylmethyl)phenyl]-6-fluoro-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccc(C[NH+]4CC=CC4)cc3)nc3cc(F)cc1c32 |
| InChI | InChI=1S/C21H19FN4O/c22-16-11-17-19-18(12-16)24-20(26(19)10-7-23-21(17)27)15-5-3-14(4-6-15)13-25-8-1-2-9-25/h1-6,11-12H,7-10,13H2,(H,23,27)/p+1 |
| InChIKey | PPQYENOKLRKDRG-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|