C16H30O2 — CID 20577982
2-[3-(4-hydroxy-4-methylpentyl)-2,2-dimethylcyclohexyl]acetaldehyde (PubChem CID 20577982) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 2-[3-(4-hydroxy-4-methylpentyl)-2,2-dimethylcyclohexyl]acetaldehyde.
| Compound Name | 2-[3-(4-hydroxy-4-methylpentyl)-2,2-dimethylcyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 20577982 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 2-[3-(4-hydroxy-4-methylpentyl)-2,2-dimethylcyclohexyl]acetaldehyde |
| SMILES | CC(C)(O)CCCC1CCCC(CC=O)C1(C)C |
| InChI | InChI=1S/C16H30O2/c1-15(2,18)11-6-9-13-7-5-8-14(10-12-17)16(13,3)4/h12-14,18H,5-11H2,1-4H3 |
| InChIKey | MKSXKUUJSCVMQS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|