C27H46O2 — CID 167490361
(4aS,6aR)-7-(5-hydroxy-5-methylhexyl)-4a,6a-dimethyl-3,4,4b,5,6,7,8,9,10,10a,10b,11,12,12a-tetradecahydro-1H-chrysen-2-one (PubChem CID 167490361) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is (4aS,6aR)-7-(5-hydroxy-5-methylhexyl)-4a,6a-dimethyl-3,4,4b,5,6,7,8,9,10,10a,10b,11,12,12a-tetradecahydro-1H-chrysen-2-one.
| Compound Name | (4aS,6aR)-7-(5-hydroxy-5-methylhexyl)-4a,6a-dimethyl-3,4,4b,5,6,7,8,9,10,10a,10b,11,12,12a-tetradecahydro-1H-chrysen-2-one |
|---|---|
| PubChem CID | 167490361 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | (4aS,6aR)-7-(5-hydroxy-5-methylhexyl)-4a,6a-dimethyl-3,4,4b,5,6,7,8,9,10,10a,10b,11,12,12a-tetradecahydro-1H-chrysen-2-one |
| SMILES | CC(C)(O)CCCCC1CCCC2C3CCC4CC(=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C27H46O2/c1-25(2,29)15-6-5-8-19-9-7-10-23-22-12-11-20-18-21(28)13-16-27(20,4)24(22)14-17-26(19,23)3/h19-20,22-24,29H,5-18H2,1-4H3/t19?,20?,22?,23?,24?,26-,27+/m1/s1 |
| InChIKey | DKFVHMGDOZCPCL-FXFWBXPPSA-N |
| XLogP | 6.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|