C28H51O3P — CID 142068968
17-(3-diethoxyphosphanylpropyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one;ethane (PubChem CID 142068968) has the molecular formula C28H51O3P and a molecular weight of 466.69 g/mol. Its IUPAC name is 17-(3-diethoxyphosphanylpropyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one;ethane.
| Compound Name | 17-(3-diethoxyphosphanylpropyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one;ethane |
|---|---|
| PubChem CID | 142068968 |
| Molecular Formula | C28H51O3P |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.36 |
| IUPAC Name | 17-(3-diethoxyphosphanylpropyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one;ethane |
| SMILES | CC.CCOP(CCCC1CCC2C3CCC4CC(=O)CCC4(C)C3CCC12C)OCC |
| InChI | InChI=1S/C26H45O3P.C2H6/c1-5-28-30(29-6-2)17-7-8-19-10-12-23-22-11-9-20-18-21(27)13-15-26(20,4)24(22)14-16-25(19,23)3;1-2/h19-20,22-24H,5-18H2,1-4H3;1-2H3 |
| InChIKey | BYMAYXAKZJTXJY-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|