C17H15ClN4O — CID 20578544
(5-chloro-2,6-dimethylpyrimidin-4-yl)-(2-methoxynaphthalen-1-yl)diazene (PubChem CID 20578544) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is (5-chloro-2,6-dimethylpyrimidin-4-yl)-(2-methoxynaphthalen-1-yl)diazene.
| Compound Name | (5-chloro-2,6-dimethylpyrimidin-4-yl)-(2-methoxynaphthalen-1-yl)diazene |
|---|---|
| PubChem CID | 20578544 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (5-chloro-2,6-dimethylpyrimidin-4-yl)-(2-methoxynaphthalen-1-yl)diazene |
| SMILES | COc1ccc2ccccc2c1/N=N/c1nc(C)nc(C)c1Cl |
| InChI | InChI=1S/C17H15ClN4O/c1-10-15(18)17(20-11(2)19-10)22-21-16-13-7-5-4-6-12(13)8-9-14(16)23-3/h4-9H,1-3H3/b22-21+ |
| InChIKey | FNVFVOADKXEFBT-QURGRASLSA-N |
| XLogP | 5.32 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|