C16H14N4O — CID 136644829
1-[(4,6-dimethylpyrimidin-2-yl)diazenyl]naphthalen-2-ol (PubChem CID 136644829) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is 1-[(4,6-dimethylpyrimidin-2-yl)diazenyl]naphthalen-2-ol.
| Compound Name | 1-[(4,6-dimethylpyrimidin-2-yl)diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136644829 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-[(4,6-dimethylpyrimidin-2-yl)diazenyl]naphthalen-2-ol |
| SMILES | Cc1cc(C)nc(/N=N/c2c(O)ccc3ccccc23)n1 |
| InChI | InChI=1S/C16H14N4O/c1-10-9-11(2)18-16(17-10)20-19-15-13-6-4-3-5-12(13)7-8-14(15)21/h3-9,21H,1-2H3/b20-19+ |
| InChIKey | YIRNIMYIQDIFFL-FMQUCBEESA-N |
| XLogP | 4.37 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|