C17H16N4O — CID 171716346
1-[C-(4,6-dimethylpyrimidin-2-yl)carbonohydrazonoyl]naphthalen-2-ol (PubChem CID 171716346) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-[C-(4,6-dimethylpyrimidin-2-yl)carbonohydrazonoyl]naphthalen-2-ol.
| Compound Name | 1-[C-(4,6-dimethylpyrimidin-2-yl)carbonohydrazonoyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 171716346 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-[C-(4,6-dimethylpyrimidin-2-yl)carbonohydrazonoyl]naphthalen-2-ol |
| SMILES | Cc1cc(C)nc(C(=NN)c2c(O)ccc3ccccc23)n1 |
| InChI | InChI=1S/C17H16N4O/c1-10-9-11(2)20-17(19-10)16(21-18)15-13-6-4-3-5-12(13)7-8-14(15)22/h3-9,22H,18H2,1-2H3 |
| InChIKey | PAJYNRNJKSVPQU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|