C22H23NO — CID 20580195
[4-(N-(2,4-dimethylphenyl)anilino)-2-methylphenyl]methanol (PubChem CID 20580195) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is [4-(N-(2,4-dimethylphenyl)anilino)-2-methylphenyl]methanol.
| Compound Name | [4-(N-(2,4-dimethylphenyl)anilino)-2-methylphenyl]methanol |
|---|---|
| PubChem CID | 20580195 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [4-(N-(2,4-dimethylphenyl)anilino)-2-methylphenyl]methanol |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(CO)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C22H23NO/c1-16-9-12-22(18(3)13-16)23(20-7-5-4-6-8-20)21-11-10-19(15-24)17(2)14-21/h4-14,24H,15H2,1-3H3 |
| InChIKey | TYCLIFCUZBXQKY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |