C17H19ClN2O3 — CID 2058206
(3aS,7aS)-5-chloro-2-[2-(4-methoxyanilino)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 2058206) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is (3aS,7aS)-5-chloro-2-[2-(4-methoxyanilino)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-5-chloro-2-[2-(4-methoxyanilino)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2058206 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (3aS,7aS)-5-chloro-2-[2-(4-methoxyanilino)ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1ccc(NCCN2C(=O)[C@H]3CC=C(Cl)C[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-23-13-5-3-12(4-6-13)19-8-9-20-16(21)14-7-2-11(18)10-15(14)17(20)22/h2-6,14-15,19H,7-10H2,1H3/t14-,15-/m0/s1 |
| InChIKey | YCJQSUFCUSANTO-GJZGRUSLSA-N |
| XLogP | 2.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|