C10H13IO5S — CID 20582454
3-(3-iodopropoxymethoxy)benzenesulfonic acid (PubChem CID 20582454) has the molecular formula C10H13IO5S and a molecular weight of 372.18 g/mol. Its IUPAC name is 3-(3-iodopropoxymethoxy)benzenesulfonic acid.
| Compound Name | 3-(3-iodopropoxymethoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 20582454 |
| Molecular Formula | C10H13IO5S |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 3-(3-iodopropoxymethoxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(OCOCCCI)c1 |
| InChI | InChI=1S/C10H13IO5S/c11-5-2-6-15-8-16-9-3-1-4-10(7-9)17(12,13)14/h1,3-4,7H,2,5-6,8H2,(H,12,13,14) |
| InChIKey | SBZHVLSIIRTVQJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|