About 4-iodo-1H-pyridin-2-one
4-iodo-1H-pyridin-2-one (PubChem CID 20582535) has the molecular formula C5H4INO
and a molecular weight of 221.00 g/mol. Its IUPAC name is 4-iodo-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-iodo-1H-pyridin-2-one |
| PubChem CID | 20582535 |
| Molecular Formula | C5H4INO |
| Molecular Weight | 221.00 g/mol |
| Exact Mass | 220.93 |
| IUPAC Name | 4-iodo-1H-pyridin-2-one |
| SMILES | O=c1cc(I)cc[nH]1 |
| InChI | InChI=1S/C5H4INO/c6-4-1-2-7-5(8)3-4/h1-3H,(H,7,8) |
| InChIKey | POHJRJNCZQENQG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.00 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-1H-pyridin-2-one?
The IUPAC name of 4-iodo-1H-pyridin-2-one (CID 20582535) is 4-iodo-1H-pyridin-2-one.
What is the SMILES notation for 4-iodo-1H-pyridin-2-one?
The canonical SMILES for 4-iodo-1H-pyridin-2-one is O=c1cc(I)cc[nH]1.
What is the InChIKey of 4-iodo-1H-pyridin-2-one?
The InChIKey is POHJRJNCZQENQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4INO/c6-4-1-2-7-5(8)3-4/h1-3H,(H,7,8).
What are the key properties of 4-iodo-1H-pyridin-2-one?
4-iodo-1H-pyridin-2-one has a molecular weight of 221.00 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-1H-pyridin-2-one is sourced from PubChem (CID 20582535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).