C15H28S — CID 20583873
4,8-dimethyl-11-propan-2-yl-1-thiaspiro[5.5]undecane (PubChem CID 20583873) has the molecular formula C15H28S and a molecular weight of 240.46 g/mol. Its IUPAC name is 4,8-dimethyl-11-propan-2-yl-1-thiaspiro[5.5]undecane.
| Compound Name | 4,8-dimethyl-11-propan-2-yl-1-thiaspiro[5.5]undecane |
|---|---|
| PubChem CID | 20583873 |
| Molecular Formula | C15H28S |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 4,8-dimethyl-11-propan-2-yl-1-thiaspiro[5.5]undecane |
| SMILES | CC1CCSC2(C1)CC(C)CCC2C(C)C |
| InChI | InChI=1S/C15H28S/c1-11(2)14-6-5-12(3)9-15(14)10-13(4)7-8-16-15/h11-14H,5-10H2,1-4H3 |
| InChIKey | COSGULUCCZZTSV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |