C12H15F2NO — CID 20584648
(E)-N-[(3,4-difluorophenyl)methoxy]-2,2-dimethylpropan-1-imine (PubChem CID 20584648) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is (E)-N-[(3,4-difluorophenyl)methoxy]-2,2-dimethylpropan-1-imine.
| Compound Name | (E)-N-[(3,4-difluorophenyl)methoxy]-2,2-dimethylpropan-1-imine |
|---|---|
| PubChem CID | 20584648 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (E)-N-[(3,4-difluorophenyl)methoxy]-2,2-dimethylpropan-1-imine |
| SMILES | CC(C)(C)/C=N/OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H15F2NO/c1-12(2,3)8-15-16-7-9-4-5-10(13)11(14)6-9/h4-6,8H,7H2,1-3H3/b15-8+ |
| InChIKey | ZKFZYMSYFBWRGV-OVCLIPMQSA-N |
| XLogP | 3.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|