C8H9F3N2O2 — CID 20587495
1-propan-2-yl-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 20587495) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 1-propan-2-yl-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-propan-2-yl-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20587495 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-propan-2-yl-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)n1cc(C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9F3N2O2/c1-4(2)13-3-5(8(9,10)11)6(14)12-7(13)15/h3-4H,1-2H3,(H,12,14,15) |
| InChIKey | LAMMLTFDTJADOA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |