C31H18F10N2O8 — CID 20588744
[1,2,2,2-tetrafluoro-1-[3-[1,1,1,3,3,3-hexafluoro-2-[(2-methyl-1,3-dioxoisoindol-5-yl)oxymethoxy]propan-2-yl]phenyl]ethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 20588744) has the molecular formula C31H18F10N2O8 and a molecular weight of 736.47 g/mol. Its IUPAC name is [1,2,2,2-tetrafluoro-1-[3-[1,1,1,3,3,3-hexafluoro-2-[(2-methyl-1,3-dioxoisoindol-5-yl)oxymethoxy]propan-2-yl]phenyl]ethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1,2,2,2-tetrafluoro-1-[3-[1,1,1,3,3,3-hexafluoro-2-[(2-methyl-1,3-dioxoisoindol-5-yl)oxymethoxy]propan-2-yl]phenyl]ethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 20588744 |
| Molecular Formula | C31H18F10N2O8 |
| Molecular Weight | 736.47 g/mol |
| Exact Mass | 736.09 |
| IUPAC Name | [1,2,2,2-tetrafluoro-1-[3-[1,1,1,3,3,3-hexafluoro-2-[(2-methyl-1,3-dioxoisoindol-5-yl)oxymethoxy]propan-2-yl]phenyl]ethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CN1C(=O)c2ccc(OCOC(c3cccc(C(F)(OC(=O)c4ccc5c(c4)C(=O)N(C)C5=O)C(F)(F)F)c3)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C31H18F10N2O8/c1-42-22(44)18-8-6-14(10-20(18)24(42)46)26(48)51-28(32,31(39,40)41)16-5-3-4-15(11-16)27(29(33,34)35,30(36,37)38)50-13-49-17-7-9-19-21(12-17)25(47)43(2)23(19)45/h3-12H,13H2,1-2H3 |
| InChIKey | LDTXOOQEDFYECB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|