About bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate
bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate (PubChem CID 20588951) has the molecular formula C11H27O13P3
and a molecular weight of 460.25 g/mol. Its IUPAC name is bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate.
Molecular Properties
| Compound Name | bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate |
| PubChem CID | 20588951 |
| Molecular Formula | C11H27O13P3 |
| Molecular Weight | 460.25 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate |
| SMILES | COP(=O)(OCCCO)OP(=O)(OCCCO)OP(=O)(OC)OCCCO |
| InChI | InChI=1S/C11H27O13P3/c1-18-25(15,20-9-3-6-12)23-27(17,22-11-5-8-14)24-26(16,19-2)21-10-4-7-13/h12-14H,3-11H2,1-2H3 |
| InChIKey | WOLQATCSZFTSAV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate?
The IUPAC name of bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate (CID 20588951) is bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate.
What is the SMILES notation for bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate?
The canonical SMILES for bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate is COP(=O)(OCCCO)OP(=O)(OCCCO)OP(=O)(OC)OCCCO.
What is the InChIKey of bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate?
The InChIKey is WOLQATCSZFTSAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27O13P3/c1-18-25(15,20-9-3-6-12)23-27(17,22-11-5-8-14)24-26(16,19-2)21-10-4-7-13/h12-14H,3-11H2,1-2H3.
What are the key properties of bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate?
bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate has a molecular weight of 460.25 g/mol, XLogP of 1.83, 18 rotatable bonds, 3 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-hydroxypropoxy(methoxy)phosphoryl] 3-hydroxypropyl phosphate is sourced from PubChem (CID 20588951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).