C13H31O13P3 — CID 150987727
[butoxy(3-hydroxypropoxy)phosphoryl] [hydroxy(3-hydroxypropoxy)phosphoryl] 3-hydroxypropyl phosphate (PubChem CID 150987727) has the molecular formula C13H31O13P3 and a molecular weight of 488.30 g/mol. Its IUPAC name is [butoxy(3-hydroxypropoxy)phosphoryl] [hydroxy(3-hydroxypropoxy)phosphoryl] 3-hydroxypropyl phosphate.
| Compound Name | [butoxy(3-hydroxypropoxy)phosphoryl] [hydroxy(3-hydroxypropoxy)phosphoryl] 3-hydroxypropyl phosphate |
|---|---|
| PubChem CID | 150987727 |
| Molecular Formula | C13H31O13P3 |
| Molecular Weight | 488.30 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | [butoxy(3-hydroxypropoxy)phosphoryl] [hydroxy(3-hydroxypropoxy)phosphoryl] 3-hydroxypropyl phosphate |
| SMILES | CCCCOP(=O)(OCCCO)OP(=O)(OCCCO)OP(=O)(O)OCCCO |
| InChI | InChI=1S/C13H31O13P3/c1-2-3-10-22-28(19,23-12-5-8-15)26-29(20,24-13-6-9-16)25-27(17,18)21-11-4-7-14/h14-16H,2-13H2,1H3,(H,17,18) |
| InChIKey | LRLCPYPTKWMSSQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 187.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|