C16H27N3O3 — CID 20590487
3-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-1-(1-methylpiperidin-4-yl)piperidin-2-one (PubChem CID 20590487) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-1-(1-methylpiperidin-4-yl)piperidin-2-one.
| Compound Name | 3-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-1-(1-methylpiperidin-4-yl)piperidin-2-one |
|---|---|
| PubChem CID | 20590487 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-1-(1-methylpiperidin-4-yl)piperidin-2-one |
| SMILES | CN1CCC(N2CCCC(CC(=O)N3CC(O)C3)C2=O)CC1 |
| InChI | InChI=1S/C16H27N3O3/c1-17-7-4-13(5-8-17)19-6-2-3-12(16(19)22)9-15(21)18-10-14(20)11-18/h12-14,20H,2-11H2,1H3 |
| InChIKey | HNJJJCGAOCGQHB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |